C18H17FN4O2S2 — CID 1400422
3-[2-[2-[(2-fluorophenyl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]-N,N-dimethylbenzenesulfonamide (PubChem CID 1400422) has the molecular formula C18H17FN4O2S2 and a molecular weight of 404.49 g/mol. Its IUPAC name is 3-[2-[2-[(2-fluorophenyl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]-N,N-dimethylbenzenesulfonamide.
| Compound Name | 3-[2-[2-[(2-fluorophenyl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 1400422 |
| Molecular Formula | C18H17FN4O2S2 |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.08 |
| IUPAC Name | 3-[2-[2-[(2-fluorophenyl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]-N,N-dimethylbenzenesulfonamide |
| SMILES | CN(C)S(=O)(=O)c1cccc(-c2csc(NN=Cc3ccccc3F)n2)c1 |
| InChI | InChI=1S/C18H17FN4O2S2/c1-23(2)27(24,25)15-8-5-7-13(10-15)17-12-26-18(21-17)22-20-11-14-6-3-4-9-16(14)19/h3-12H,1-2H3,(H,21,22) |
| InChIKey | KUBHPFZHGUSUBD-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 74.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|