C20H24N4O2S3 — CID 4701466
N,N-dipropyl-3-[2-[2-(thiophen-2-ylmethylidene)hydrazinyl]-1,3-thiazol-4-yl]benzenesulfonamide (PubChem CID 4701466) has the molecular formula C20H24N4O2S3 and a molecular weight of 448.64 g/mol. Its IUPAC name is N,N-dipropyl-3-[2-[2-(thiophen-2-ylmethylidene)hydrazinyl]-1,3-thiazol-4-yl]benzenesulfonamide.
| Compound Name | N,N-dipropyl-3-[2-[2-(thiophen-2-ylmethylidene)hydrazinyl]-1,3-thiazol-4-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 4701466 |
| Molecular Formula | C20H24N4O2S3 |
| Molecular Weight | 448.64 g/mol |
| Exact Mass | 448.11 |
| IUPAC Name | N,N-dipropyl-3-[2-[2-(thiophen-2-ylmethylidene)hydrazinyl]-1,3-thiazol-4-yl]benzenesulfonamide |
| SMILES | CCCN(CCC)S(=O)(=O)c1cccc(-c2csc(NN=Cc3cccs3)n2)c1 |
| InChI | InChI=1S/C20H24N4O2S3/c1-3-10-24(11-4-2)29(25,26)18-9-5-7-16(13-18)19-15-28-20(22-19)23-21-14-17-8-6-12-27-17/h5-9,12-15H,3-4,10-11H2,1-2H3,(H,22,23) |
| InChIKey | ZQPXPRIGALZEBY-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 74.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.64 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|