C19H20N4O2S3 — CID 5230382
4-(4-piperidin-1-ylsulfonylphenyl)-N-(thiophen-2-ylmethylideneamino)-1,3-thiazol-2-amine (PubChem CID 5230382) has the molecular formula C19H20N4O2S3 and a molecular weight of 432.60 g/mol. Its IUPAC name is 4-(4-piperidin-1-ylsulfonylphenyl)-N-(thiophen-2-ylmethylideneamino)-1,3-thiazol-2-amine.
| Compound Name | 4-(4-piperidin-1-ylsulfonylphenyl)-N-(thiophen-2-ylmethylideneamino)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 5230382 |
| Molecular Formula | C19H20N4O2S3 |
| Molecular Weight | 432.60 g/mol |
| Exact Mass | 432.07 |
| IUPAC Name | 4-(4-piperidin-1-ylsulfonylphenyl)-N-(thiophen-2-ylmethylideneamino)-1,3-thiazol-2-amine |
| SMILES | O=S(=O)(c1ccc(-c2csc(NN=Cc3cccs3)n2)cc1)N1CCCCC1 |
| InChI | InChI=1S/C19H20N4O2S3/c24-28(25,23-10-2-1-3-11-23)17-8-6-15(7-9-17)18-14-27-19(21-18)22-20-13-16-5-4-12-26-16/h4-9,12-14H,1-3,10-11H2,(H,21,22) |
| InChIKey | QYCHRZZEYSTEOW-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 74.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.60 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|