C23H26N4O2S2 — CID 5230376
N-[(4-propan-2-ylphenyl)methylideneamino]-4-(4-pyrrolidin-1-ylsulfonylphenyl)-1,3-thiazol-2-amine (PubChem CID 5230376) has the molecular formula C23H26N4O2S2 and a molecular weight of 454.62 g/mol. Its IUPAC name is N-[(4-propan-2-ylphenyl)methylideneamino]-4-(4-pyrrolidin-1-ylsulfonylphenyl)-1,3-thiazol-2-amine.
| Compound Name | N-[(4-propan-2-ylphenyl)methylideneamino]-4-(4-pyrrolidin-1-ylsulfonylphenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 5230376 |
| Molecular Formula | C23H26N4O2S2 |
| Molecular Weight | 454.62 g/mol |
| Exact Mass | 454.15 |
| IUPAC Name | N-[(4-propan-2-ylphenyl)methylideneamino]-4-(4-pyrrolidin-1-ylsulfonylphenyl)-1,3-thiazol-2-amine |
| SMILES | CC(C)c1ccc(C=NNc2nc(-c3ccc(S(=O)(=O)N4CCCC4)cc3)cs2)cc1 |
| InChI | InChI=1S/C23H26N4O2S2/c1-17(2)19-7-5-18(6-8-19)15-24-26-23-25-22(16-30-23)20-9-11-21(12-10-20)31(28,29)27-13-3-4-14-27/h5-12,15-17H,3-4,13-14H2,1-2H3,(H,25,26) |
| InChIKey | LWCMOSKBZWHGEL-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 74.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.62 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|