C22H24N4O3S2 — CID 6276598
N-[(Z)-(4-methoxyphenyl)methylideneamino]-4-(4-piperidin-1-ylsulfonylphenyl)-1,3-thiazol-2-amine (PubChem CID 6276598) has the molecular formula C22H24N4O3S2 and a molecular weight of 456.59 g/mol. Its IUPAC name is N-[(Z)-(4-methoxyphenyl)methylideneamino]-4-(4-piperidin-1-ylsulfonylphenyl)-1,3-thiazol-2-amine.
| Compound Name | N-[(Z)-(4-methoxyphenyl)methylideneamino]-4-(4-piperidin-1-ylsulfonylphenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 6276598 |
| Molecular Formula | C22H24N4O3S2 |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.13 |
| IUPAC Name | N-[(Z)-(4-methoxyphenyl)methylideneamino]-4-(4-piperidin-1-ylsulfonylphenyl)-1,3-thiazol-2-amine |
| SMILES | COc1ccc(/C=N\Nc2nc(-c3ccc(S(=O)(=O)N4CCCCC4)cc3)cs2)cc1 |
| InChI | InChI=1S/C22H24N4O3S2/c1-29-19-9-5-17(6-10-19)15-23-25-22-24-21(16-30-22)18-7-11-20(12-8-18)31(27,28)26-13-3-2-4-14-26/h5-12,15-16H,2-4,13-14H2,1H3,(H,24,25)/b23-15- |
| InChIKey | GMPGAYNHAVRCFB-HAHDFKILSA-N |
| XLogP | 4.44 |
| TPSA | 83.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|