C24H30N4O4S2 — CID 4701568
3-[2-[2-[(2,4-dimethoxyphenyl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]-N,N-dipropylbenzenesulfonamide (PubChem CID 4701568) has the molecular formula C24H30N4O4S2 and a molecular weight of 502.66 g/mol. Its IUPAC name is 3-[2-[2-[(2,4-dimethoxyphenyl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]-N,N-dipropylbenzenesulfonamide.
| Compound Name | 3-[2-[2-[(2,4-dimethoxyphenyl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]-N,N-dipropylbenzenesulfonamide |
|---|---|
| PubChem CID | 4701568 |
| Molecular Formula | C24H30N4O4S2 |
| Molecular Weight | 502.66 g/mol |
| Exact Mass | 502.17 |
| IUPAC Name | 3-[2-[2-[(2,4-dimethoxyphenyl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]-N,N-dipropylbenzenesulfonamide |
| SMILES | CCCN(CCC)S(=O)(=O)c1cccc(-c2csc(NN=Cc3ccc(OC)cc3OC)n2)c1 |
| InChI | InChI=1S/C24H30N4O4S2/c1-5-12-28(13-6-2)34(29,30)21-9-7-8-18(14-21)22-17-33-24(26-22)27-25-16-19-10-11-20(31-3)15-23(19)32-4/h7-11,14-17H,5-6,12-13H2,1-4H3,(H,26,27) |
| InChIKey | NKRPPRDNORTSOV-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 93.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.66 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|