C26H30N4O6S2 — CID 6222542
ethyl 1-[3-[2-[(2Z)-2-[(2,4-dimethoxyphenyl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]phenyl]sulfonylpiperidine-4-carboxylate (PubChem CID 6222542) has the molecular formula C26H30N4O6S2 and a molecular weight of 558.68 g/mol. Its IUPAC name is ethyl 1-[3-[2-[(2Z)-2-[(2,4-dimethoxyphenyl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]phenyl]sulfonylpiperidine-4-carboxylate.
| Compound Name | ethyl 1-[3-[2-[(2Z)-2-[(2,4-dimethoxyphenyl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]phenyl]sulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 6222542 |
| Molecular Formula | C26H30N4O6S2 |
| Molecular Weight | 558.68 g/mol |
| Exact Mass | 558.16 |
| IUPAC Name | ethyl 1-[3-[2-[(2Z)-2-[(2,4-dimethoxyphenyl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]phenyl]sulfonylpiperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(S(=O)(=O)c2cccc(-c3csc(N/N=C\c4ccc(OC)cc4OC)n3)c2)CC1 |
| InChI | InChI=1S/C26H30N4O6S2/c1-4-36-25(31)18-10-12-30(13-11-18)38(32,33)22-7-5-6-19(14-22)23-17-37-26(28-23)29-27-16-20-8-9-21(34-2)15-24(20)35-3/h5-9,14-18H,4,10-13H2,1-3H3,(H,28,29)/b27-16- |
| InChIKey | HNLFWSZLRCUTLF-YUMHPJSZSA-N |
| XLogP | 4.24 |
| TPSA | 119.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.68 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|