C24H28N4O5S2 — CID 27571794
N-[(Z)-(2,4-dimethoxyphenyl)methylideneamino]-4-[3-[(2R,6R)-2,6-dimethylmorpholin-4-yl]sulfonylphenyl]-1,3-thiazol-2-amine (PubChem CID 27571794) has the molecular formula C24H28N4O5S2 and a molecular weight of 516.65 g/mol. Its IUPAC name is N-[(Z)-(2,4-dimethoxyphenyl)methylideneamino]-4-[3-[(2R,6R)-2,6-dimethylmorpholin-4-yl]sulfonylphenyl]-1,3-thiazol-2-amine.
| Compound Name | N-[(Z)-(2,4-dimethoxyphenyl)methylideneamino]-4-[3-[(2R,6R)-2,6-dimethylmorpholin-4-yl]sulfonylphenyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 27571794 |
| Molecular Formula | C24H28N4O5S2 |
| Molecular Weight | 516.65 g/mol |
| Exact Mass | 516.15 |
| IUPAC Name | N-[(Z)-(2,4-dimethoxyphenyl)methylideneamino]-4-[3-[(2R,6R)-2,6-dimethylmorpholin-4-yl]sulfonylphenyl]-1,3-thiazol-2-amine |
| SMILES | COc1ccc(/C=N\Nc2nc(-c3cccc(S(=O)(=O)N4C[C@@H](C)O[C@H](C)C4)c3)cs2)c(OC)c1 |
| InChI | InChI=1S/C24H28N4O5S2/c1-16-13-28(14-17(2)33-16)35(29,30)21-7-5-6-18(10-21)22-15-34-24(26-22)27-25-12-19-8-9-20(31-3)11-23(19)32-4/h5-12,15-17H,13-14H2,1-4H3,(H,26,27)/b25-12-/t16-,17-/m1/s1 |
| InChIKey | FZPABYGFSJFUKV-DTBYOGDJSA-N |
| XLogP | 4.07 |
| TPSA | 102.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.65 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|