C20H20N4O4S2 — CID 1402433
3-[[[4-(3-morpholin-4-ylsulfonylphenyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]phenol (PubChem CID 1402433) has the molecular formula C20H20N4O4S2 and a molecular weight of 444.54 g/mol. Its IUPAC name is 3-[[[4-(3-morpholin-4-ylsulfonylphenyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]phenol.
| Compound Name | 3-[[[4-(3-morpholin-4-ylsulfonylphenyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]phenol |
|---|---|
| PubChem CID | 1402433 |
| Molecular Formula | C20H20N4O4S2 |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.09 |
| IUPAC Name | 3-[[[4-(3-morpholin-4-ylsulfonylphenyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]phenol |
| SMILES | O=S(=O)(c1cccc(-c2csc(NN=Cc3cccc(O)c3)n2)c1)N1CCOCC1 |
| InChI | InChI=1S/C20H20N4O4S2/c25-17-5-1-3-15(11-17)13-21-23-20-22-19(14-29-20)16-4-2-6-18(12-16)30(26,27)24-7-9-28-10-8-24/h1-6,11-14,25H,7-10H2,(H,22,23) |
| InChIKey | AWRIRZBKZPIFNI-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 104.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|