C22H24N4O3S2 — CID 4701593
4-[[[4-[3-(3-methylpiperidin-1-yl)sulfonylphenyl]-1,3-thiazol-2-yl]hydrazinylidene]methyl]phenol (PubChem CID 4701593) has the molecular formula C22H24N4O3S2 and a molecular weight of 456.59 g/mol. Its IUPAC name is 4-[[[4-[3-(3-methylpiperidin-1-yl)sulfonylphenyl]-1,3-thiazol-2-yl]hydrazinylidene]methyl]phenol.
| Compound Name | 4-[[[4-[3-(3-methylpiperidin-1-yl)sulfonylphenyl]-1,3-thiazol-2-yl]hydrazinylidene]methyl]phenol |
|---|---|
| PubChem CID | 4701593 |
| Molecular Formula | C22H24N4O3S2 |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.13 |
| IUPAC Name | 4-[[[4-[3-(3-methylpiperidin-1-yl)sulfonylphenyl]-1,3-thiazol-2-yl]hydrazinylidene]methyl]phenol |
| SMILES | CC1CCCN(S(=O)(=O)c2cccc(-c3csc(NN=Cc4ccc(O)cc4)n3)c2)C1 |
| InChI | InChI=1S/C22H24N4O3S2/c1-16-4-3-11-26(14-16)31(28,29)20-6-2-5-18(12-20)21-15-30-22(24-21)25-23-13-17-7-9-19(27)10-8-17/h2,5-10,12-13,15-16,27H,3-4,11,14H2,1H3,(H,24,25) |
| InChIKey | XODMJOXHCPOBOZ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 94.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|