C23H25ClN4O2S2 — CID 4701488
N-[(3-chlorophenyl)methylideneamino]-4-[3-(3,5-dimethylpiperidin-1-yl)sulfonylphenyl]-1,3-thiazol-2-amine (PubChem CID 4701488) has the molecular formula C23H25ClN4O2S2 and a molecular weight of 489.07 g/mol. Its IUPAC name is N-[(3-chlorophenyl)methylideneamino]-4-[3-(3,5-dimethylpiperidin-1-yl)sulfonylphenyl]-1,3-thiazol-2-amine.
| Compound Name | N-[(3-chlorophenyl)methylideneamino]-4-[3-(3,5-dimethylpiperidin-1-yl)sulfonylphenyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 4701488 |
| Molecular Formula | C23H25ClN4O2S2 |
| Molecular Weight | 489.07 g/mol |
| Exact Mass | 488.11 |
| IUPAC Name | N-[(3-chlorophenyl)methylideneamino]-4-[3-(3,5-dimethylpiperidin-1-yl)sulfonylphenyl]-1,3-thiazol-2-amine |
| SMILES | CC1CC(C)CN(S(=O)(=O)c2cccc(-c3csc(NN=Cc4cccc(Cl)c4)n3)c2)C1 |
| InChI | InChI=1S/C23H25ClN4O2S2/c1-16-9-17(2)14-28(13-16)32(29,30)21-8-4-6-19(11-21)22-15-31-23(26-22)27-25-12-18-5-3-7-20(24)10-18/h3-8,10-12,15-17H,9,13-14H2,1-2H3,(H,26,27) |
| InChIKey | WCFRESYUSRTZOW-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 74.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.07 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|