C24H28N4O4S2 — CID 135607803
4-[(E)-[[4-[3-(3,5-dimethylpiperidin-1-yl)sulfonylphenyl]-1,3-thiazol-2-yl]hydrazinylidene]methyl]-2-methoxyphenol (PubChem CID 135607803) has the molecular formula C24H28N4O4S2 and a molecular weight of 500.65 g/mol. Its IUPAC name is 4-[(E)-[[4-[3-(3,5-dimethylpiperidin-1-yl)sulfonylphenyl]-1,3-thiazol-2-yl]hydrazinylidene]methyl]-2-methoxyphenol.
| Compound Name | 4-[(E)-[[4-[3-(3,5-dimethylpiperidin-1-yl)sulfonylphenyl]-1,3-thiazol-2-yl]hydrazinylidene]methyl]-2-methoxyphenol |
|---|---|
| PubChem CID | 135607803 |
| Molecular Formula | C24H28N4O4S2 |
| Molecular Weight | 500.65 g/mol |
| Exact Mass | 500.16 |
| IUPAC Name | 4-[(E)-[[4-[3-(3,5-dimethylpiperidin-1-yl)sulfonylphenyl]-1,3-thiazol-2-yl]hydrazinylidene]methyl]-2-methoxyphenol |
| SMILES | COc1cc(/C=N/Nc2nc(-c3cccc(S(=O)(=O)N4CC(C)CC(C)C4)c3)cs2)ccc1O |
| InChI | InChI=1S/C24H28N4O4S2/c1-16-9-17(2)14-28(13-16)34(30,31)20-6-4-5-19(11-20)21-15-33-24(26-21)27-25-12-18-7-8-22(29)23(10-18)32-3/h4-8,10-12,15-17,29H,9,13-14H2,1-3H3,(H,26,27)/b25-12+ |
| InChIKey | LEXZEURVDRPBSH-BRJLIKDPSA-N |
| XLogP | 4.64 |
| TPSA | 104.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.65 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|