C22H23ClN4O2S2 — CID 4701479
N-[(2-chlorophenyl)methylideneamino]-4-[3-(3-methylpiperidin-1-yl)sulfonylphenyl]-1,3-thiazol-2-amine (PubChem CID 4701479) has the molecular formula C22H23ClN4O2S2 and a molecular weight of 475.04 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methylideneamino]-4-[3-(3-methylpiperidin-1-yl)sulfonylphenyl]-1,3-thiazol-2-amine.
| Compound Name | N-[(2-chlorophenyl)methylideneamino]-4-[3-(3-methylpiperidin-1-yl)sulfonylphenyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 4701479 |
| Molecular Formula | C22H23ClN4O2S2 |
| Molecular Weight | 475.04 g/mol |
| Exact Mass | 474.10 |
| IUPAC Name | N-[(2-chlorophenyl)methylideneamino]-4-[3-(3-methylpiperidin-1-yl)sulfonylphenyl]-1,3-thiazol-2-amine |
| SMILES | CC1CCCN(S(=O)(=O)c2cccc(-c3csc(NN=Cc4ccccc4Cl)n3)c2)C1 |
| InChI | InChI=1S/C22H23ClN4O2S2/c1-16-6-5-11-27(14-16)31(28,29)19-9-4-8-17(12-19)21-15-30-22(25-21)26-24-13-18-7-2-3-10-20(18)23/h2-4,7-10,12-13,15-16H,5-6,11,14H2,1H3,(H,25,26) |
| InChIKey | GOCJCBPWUMBACZ-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 74.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.04 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|