C28H27ClN4O2S2 — CID 6048757
4-[4-(4-benzylpiperidin-1-yl)sulfonylphenyl]-N-[(Z)-(3-chlorophenyl)methylideneamino]-1,3-thiazol-2-amine (PubChem CID 6048757) has the molecular formula C28H27ClN4O2S2 and a molecular weight of 551.14 g/mol. Its IUPAC name is 4-[4-(4-benzylpiperidin-1-yl)sulfonylphenyl]-N-[(Z)-(3-chlorophenyl)methylideneamino]-1,3-thiazol-2-amine.
| Compound Name | 4-[4-(4-benzylpiperidin-1-yl)sulfonylphenyl]-N-[(Z)-(3-chlorophenyl)methylideneamino]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 6048757 |
| Molecular Formula | C28H27ClN4O2S2 |
| Molecular Weight | 551.14 g/mol |
| Exact Mass | 550.13 |
| IUPAC Name | 4-[4-(4-benzylpiperidin-1-yl)sulfonylphenyl]-N-[(Z)-(3-chlorophenyl)methylideneamino]-1,3-thiazol-2-amine |
| SMILES | O=S(=O)(c1ccc(-c2csc(N/N=C\c3cccc(Cl)c3)n2)cc1)N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C28H27ClN4O2S2/c29-25-8-4-7-23(18-25)19-30-32-28-31-27(20-36-28)24-9-11-26(12-10-24)37(34,35)33-15-13-22(14-16-33)17-21-5-2-1-3-6-21/h1-12,18-20,22H,13-17H2,(H,31,32)/b30-19- |
| InChIKey | XHTLVMLLAHPSJH-FSGOGVSDSA-N |
| XLogP | 6.55 |
| TPSA | 74.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.14 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|