C12H9FN4S — CID 168627908
2-N-[(4-ethynyl-3-fluorophenyl)methylideneamino]-1,3-thiazole-2,4-diamine (PubChem CID 168627908) has the molecular formula C12H9FN4S and a molecular weight of 260.30 g/mol. Its IUPAC name is 2-N-[(4-ethynyl-3-fluorophenyl)methylideneamino]-1,3-thiazole-2,4-diamine.
| Compound Name | 2-N-[(4-ethynyl-3-fluorophenyl)methylideneamino]-1,3-thiazole-2,4-diamine |
|---|---|
| PubChem CID | 168627908 |
| Molecular Formula | C12H9FN4S |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.05 |
| IUPAC Name | 2-N-[(4-ethynyl-3-fluorophenyl)methylideneamino]-1,3-thiazole-2,4-diamine |
| SMILES | C#Cc1ccc(C=NNc2nc(N)cs2)cc1F |
| InChI | InChI=1S/C12H9FN4S/c1-2-9-4-3-8(5-10(9)13)6-15-17-12-16-11(14)7-18-12/h1,3-7H,14H2,(H,16,17) |
| InChIKey | GJIKABJDORYTMD-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|