C11H7F2N5S — CID 168627739
4-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]-2,5-difluorobenzonitrile (PubChem CID 168627739) has the molecular formula C11H7F2N5S and a molecular weight of 279.28 g/mol. Its IUPAC name is 4-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]-2,5-difluorobenzonitrile.
| Compound Name | 4-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]-2,5-difluorobenzonitrile |
|---|---|
| PubChem CID | 168627739 |
| Molecular Formula | C11H7F2N5S |
| Molecular Weight | 279.28 g/mol |
| Exact Mass | 279.04 |
| IUPAC Name | 4-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]-2,5-difluorobenzonitrile |
| SMILES | N#Cc1cc(F)c(C=NNc2nc(N)cs2)cc1F |
| InChI | InChI=1S/C11H7F2N5S/c12-8-2-7(9(13)1-6(8)3-14)4-16-18-11-17-10(15)5-19-11/h1-2,4-5H,15H2,(H,17,18) |
| InChIKey | ZIJMOCRPPNTNCO-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 87.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.28 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|