C14H11FN4S — CID 168628178
2-N-[(1-fluoronaphthalen-2-yl)methylideneamino]-1,3-thiazole-2,4-diamine (PubChem CID 168628178) has the molecular formula C14H11FN4S and a molecular weight of 286.34 g/mol. Its IUPAC name is 2-N-[(1-fluoronaphthalen-2-yl)methylideneamino]-1,3-thiazole-2,4-diamine.
| Compound Name | 2-N-[(1-fluoronaphthalen-2-yl)methylideneamino]-1,3-thiazole-2,4-diamine |
|---|---|
| PubChem CID | 168628178 |
| Molecular Formula | C14H11FN4S |
| Molecular Weight | 286.34 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | 2-N-[(1-fluoronaphthalen-2-yl)methylideneamino]-1,3-thiazole-2,4-diamine |
| SMILES | Nc1csc(NN=Cc2ccc3ccccc3c2F)n1 |
| InChI | InChI=1S/C14H11FN4S/c15-13-10(6-5-9-3-1-2-4-11(9)13)7-17-19-14-18-12(16)8-20-14/h1-8H,16H2,(H,18,19) |
| InChIKey | LWNDGCINXAIMRZ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.34 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|