C11H13N5O2S2 — CID 168627401
N-[2-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenyl]methanesulfonamide (PubChem CID 168627401) has the molecular formula C11H13N5O2S2 and a molecular weight of 311.39 g/mol. Its IUPAC name is N-[2-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenyl]methanesulfonamide.
| Compound Name | N-[2-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 168627401 |
| Molecular Formula | C11H13N5O2S2 |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.05 |
| IUPAC Name | N-[2-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1ccccc1C=NNc1nc(N)cs1 |
| InChI | InChI=1S/C11H13N5O2S2/c1-20(17,18)16-9-5-3-2-4-8(9)6-13-15-11-14-10(12)7-19-11/h2-7,16H,12H2,1H3,(H,14,15) |
| InChIKey | GABXTJNZFIZSST-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 109.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|