C17H16N4O2S2 — CID 168627757
2-N-[[2-(4-methylphenyl)sulfonylphenyl]methylideneamino]-1,3-thiazole-2,4-diamine (PubChem CID 168627757) has the molecular formula C17H16N4O2S2 and a molecular weight of 372.48 g/mol. Its IUPAC name is 2-N-[[2-(4-methylphenyl)sulfonylphenyl]methylideneamino]-1,3-thiazole-2,4-diamine.
| Compound Name | 2-N-[[2-(4-methylphenyl)sulfonylphenyl]methylideneamino]-1,3-thiazole-2,4-diamine |
|---|---|
| PubChem CID | 168627757 |
| Molecular Formula | C17H16N4O2S2 |
| Molecular Weight | 372.48 g/mol |
| Exact Mass | 372.07 |
| IUPAC Name | 2-N-[[2-(4-methylphenyl)sulfonylphenyl]methylideneamino]-1,3-thiazole-2,4-diamine |
| SMILES | Cc1ccc(S(=O)(=O)c2ccccc2C=NNc2nc(N)cs2)cc1 |
| InChI | InChI=1S/C17H16N4O2S2/c1-12-6-8-14(9-7-12)25(22,23)15-5-3-2-4-13(15)10-19-21-17-20-16(18)11-24-17/h2-11H,18H2,1H3,(H,20,21) |
| InChIKey | PYUGGGFFBAMLPZ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 97.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.48 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|