C11H8F4N4S — CID 168625568
2-N-[[2-fluoro-5-(trifluoromethyl)phenyl]methylideneamino]-1,3-thiazole-2,4-diamine (PubChem CID 168625568) has the molecular formula C11H8F4N4S and a molecular weight of 304.27 g/mol. Its IUPAC name is 2-N-[[2-fluoro-5-(trifluoromethyl)phenyl]methylideneamino]-1,3-thiazole-2,4-diamine.
| Compound Name | 2-N-[[2-fluoro-5-(trifluoromethyl)phenyl]methylideneamino]-1,3-thiazole-2,4-diamine |
|---|---|
| PubChem CID | 168625568 |
| Molecular Formula | C11H8F4N4S |
| Molecular Weight | 304.27 g/mol |
| Exact Mass | 304.04 |
| IUPAC Name | 2-N-[[2-fluoro-5-(trifluoromethyl)phenyl]methylideneamino]-1,3-thiazole-2,4-diamine |
| SMILES | Nc1csc(NN=Cc2cc(C(F)(F)F)ccc2F)n1 |
| InChI | InChI=1S/C11H8F4N4S/c12-8-2-1-7(11(13,14)15)3-6(8)4-17-19-10-18-9(16)5-20-10/h1-5H,16H2,(H,18,19) |
| InChIKey | VZDZOHUGWSKVTE-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.27 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|