C12H13FN4S — CID 168627080
2-N-[(4-fluoro-3,5-dimethylphenyl)methylideneamino]-1,3-thiazole-2,4-diamine (PubChem CID 168627080) has the molecular formula C12H13FN4S and a molecular weight of 264.33 g/mol. Its IUPAC name is 2-N-[(4-fluoro-3,5-dimethylphenyl)methylideneamino]-1,3-thiazole-2,4-diamine.
| Compound Name | 2-N-[(4-fluoro-3,5-dimethylphenyl)methylideneamino]-1,3-thiazole-2,4-diamine |
|---|---|
| PubChem CID | 168627080 |
| Molecular Formula | C12H13FN4S |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | 2-N-[(4-fluoro-3,5-dimethylphenyl)methylideneamino]-1,3-thiazole-2,4-diamine |
| SMILES | Cc1cc(C=NNc2nc(N)cs2)cc(C)c1F |
| InChI | InChI=1S/C12H13FN4S/c1-7-3-9(4-8(2)11(7)13)5-15-17-12-16-10(14)6-18-12/h3-6H,14H2,1-2H3,(H,16,17) |
| InChIKey | HASJHDSZHNXTQE-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|