C16H12ClFN4S — CID 168628160
2-N-[[4-(4-chloro-3-fluorophenyl)phenyl]methylideneamino]-1,3-thiazole-2,4-diamine (PubChem CID 168628160) has the molecular formula C16H12ClFN4S and a molecular weight of 346.82 g/mol. Its IUPAC name is 2-N-[[4-(4-chloro-3-fluorophenyl)phenyl]methylideneamino]-1,3-thiazole-2,4-diamine.
| Compound Name | 2-N-[[4-(4-chloro-3-fluorophenyl)phenyl]methylideneamino]-1,3-thiazole-2,4-diamine |
|---|---|
| PubChem CID | 168628160 |
| Molecular Formula | C16H12ClFN4S |
| Molecular Weight | 346.82 g/mol |
| Exact Mass | 346.05 |
| IUPAC Name | 2-N-[[4-(4-chloro-3-fluorophenyl)phenyl]methylideneamino]-1,3-thiazole-2,4-diamine |
| SMILES | Nc1csc(NN=Cc2ccc(-c3ccc(Cl)c(F)c3)cc2)n1 |
| InChI | InChI=1S/C16H12ClFN4S/c17-13-6-5-12(7-14(13)18)11-3-1-10(2-4-11)8-20-22-16-21-15(19)9-23-16/h1-9H,19H2,(H,21,22) |
| InChIKey | ZUYXMYMQZAWZLB-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.82 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|