C14H9F5N2O — CID 98000610
1-(2,5-difluorophenyl)-3-[4-(trifluoromethyl)phenyl]urea (PubChem CID 98000610) has the molecular formula C14H9F5N2O and a molecular weight of 316.23 g/mol. Its IUPAC name is 1-(2,5-difluorophenyl)-3-[4-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-(2,5-difluorophenyl)-3-[4-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 98000610 |
| Molecular Formula | C14H9F5N2O |
| Molecular Weight | 316.23 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | 1-(2,5-difluorophenyl)-3-[4-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(Nc1ccc(C(F)(F)F)cc1)Nc1cc(F)ccc1F |
| InChI | InChI=1S/C14H9F5N2O/c15-9-3-6-11(16)12(7-9)21-13(22)20-10-4-1-8(2-5-10)14(17,18)19/h1-7H,(H2,20,21,22) |
| InChIKey | COPUURFNOBIIGK-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.23 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |