C17H13F4N3O2 — CID 78427114
(Z)-3-[4-[[2-fluoro-5-(trifluoromethyl)phenyl]carbamoylamino]phenyl]prop-2-enamide (PubChem CID 78427114) has the molecular formula C17H13F4N3O2 and a molecular weight of 367.30 g/mol. Its IUPAC name is (Z)-3-[4-[[2-fluoro-5-(trifluoromethyl)phenyl]carbamoylamino]phenyl]prop-2-enamide.
| Compound Name | (Z)-3-[4-[[2-fluoro-5-(trifluoromethyl)phenyl]carbamoylamino]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 78427114 |
| Molecular Formula | C17H13F4N3O2 |
| Molecular Weight | 367.30 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | (Z)-3-[4-[[2-fluoro-5-(trifluoromethyl)phenyl]carbamoylamino]phenyl]prop-2-enamide |
| SMILES | NC(=O)/C=C\c1ccc(NC(=O)Nc2cc(C(F)(F)F)ccc2F)cc1 |
| InChI | InChI=1S/C17H13F4N3O2/c18-13-7-4-11(17(19,20)21)9-14(13)24-16(26)23-12-5-1-10(2-6-12)3-8-15(22)25/h1-9H,(H2,22,25)(H2,23,24,26)/b8-3- |
| InChIKey | WERBOMWQBLUEMC-BAQGIRSFSA-N |
| XLogP | 3.99 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.30 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|