C17H14F4N2O3 — CID 1298541
ethyl 4-[[2-fluoro-5-(trifluoromethyl)phenyl]carbamoylamino]benzoate (PubChem CID 1298541) has the molecular formula C17H14F4N2O3 and a molecular weight of 370.30 g/mol. Its IUPAC name is ethyl 4-[[2-fluoro-5-(trifluoromethyl)phenyl]carbamoylamino]benzoate.
| Compound Name | ethyl 4-[[2-fluoro-5-(trifluoromethyl)phenyl]carbamoylamino]benzoate |
|---|---|
| PubChem CID | 1298541 |
| Molecular Formula | C17H14F4N2O3 |
| Molecular Weight | 370.30 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | ethyl 4-[[2-fluoro-5-(trifluoromethyl)phenyl]carbamoylamino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)Nc2cc(C(F)(F)F)ccc2F)cc1 |
| InChI | InChI=1S/C17H14F4N2O3/c1-2-26-15(24)10-3-6-12(7-4-10)22-16(25)23-14-9-11(17(19,20)21)5-8-13(14)18/h3-9H,2H2,1H3,(H2,22,23,25) |
| InChIKey | IGBIQTFLFXJHDG-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.30 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |