C18H13F4N3O3 — CID 175407578
methyl 5-fluoro-3-[[4-(trifluoromethyl)phenyl]carbamoylamino]indole-1-carboxylate (PubChem CID 175407578) has the molecular formula C18H13F4N3O3 and a molecular weight of 395.31 g/mol. Its IUPAC name is methyl 5-fluoro-3-[[4-(trifluoromethyl)phenyl]carbamoylamino]indole-1-carboxylate.
| Compound Name | methyl 5-fluoro-3-[[4-(trifluoromethyl)phenyl]carbamoylamino]indole-1-carboxylate |
|---|---|
| PubChem CID | 175407578 |
| Molecular Formula | C18H13F4N3O3 |
| Molecular Weight | 395.31 g/mol |
| Exact Mass | 395.09 |
| IUPAC Name | methyl 5-fluoro-3-[[4-(trifluoromethyl)phenyl]carbamoylamino]indole-1-carboxylate |
| SMILES | COC(=O)n1cc(NC(=O)Nc2ccc(C(F)(F)F)cc2)c2cc(F)ccc21 |
| InChI | InChI=1S/C18H13F4N3O3/c1-28-17(27)25-9-14(13-8-11(19)4-7-15(13)25)24-16(26)23-12-5-2-10(3-6-12)18(20,21)22/h2-9H,1H3,(H2,23,24,26) |
| InChIKey | BBLNMNRYCIFMPU-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.31 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |