C24H18F4N3O6P — CID 175408289
[2-[5-fluoro-3-[[4-(trifluoromethyl)phenyl]carbamoylamino]indole-1-carbonyl]phenyl]methyl dihydrogen phosphate (PubChem CID 175408289) has the molecular formula C24H18F4N3O6P and a molecular weight of 551.39 g/mol. Its IUPAC name is [2-[5-fluoro-3-[[4-(trifluoromethyl)phenyl]carbamoylamino]indole-1-carbonyl]phenyl]methyl dihydrogen phosphate.
| Compound Name | [2-[5-fluoro-3-[[4-(trifluoromethyl)phenyl]carbamoylamino]indole-1-carbonyl]phenyl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 175408289 |
| Molecular Formula | C24H18F4N3O6P |
| Molecular Weight | 551.39 g/mol |
| Exact Mass | 551.09 |
| IUPAC Name | [2-[5-fluoro-3-[[4-(trifluoromethyl)phenyl]carbamoylamino]indole-1-carbonyl]phenyl]methyl dihydrogen phosphate |
| SMILES | O=C(Nc1ccc(C(F)(F)F)cc1)Nc1cn(C(=O)c2ccccc2COP(=O)(O)O)c2ccc(F)cc12 |
| InChI | InChI=1S/C24H18F4N3O6P/c25-16-7-10-21-19(11-16)20(30-23(33)29-17-8-5-15(6-9-17)24(26,27)28)12-31(21)22(32)18-4-2-1-3-14(18)13-37-38(34,35)36/h1-12H,13H2,(H2,29,30,33)(H2,34,35,36) |
| InChIKey | DYLRLWOYXFZCEH-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 129.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.39 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|