C26H23FN3O6P — CID 175407791
[2-[3-[(4-cyclopropylphenyl)carbamoylamino]-5-fluoroindole-1-carbonyl]phenyl]methyl dihydrogen phosphate (PubChem CID 175407791) has the molecular formula C26H23FN3O6P and a molecular weight of 523.46 g/mol. Its IUPAC name is [2-[3-[(4-cyclopropylphenyl)carbamoylamino]-5-fluoroindole-1-carbonyl]phenyl]methyl dihydrogen phosphate.
| Compound Name | [2-[3-[(4-cyclopropylphenyl)carbamoylamino]-5-fluoroindole-1-carbonyl]phenyl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 175407791 |
| Molecular Formula | C26H23FN3O6P |
| Molecular Weight | 523.46 g/mol |
| Exact Mass | 523.13 |
| IUPAC Name | [2-[3-[(4-cyclopropylphenyl)carbamoylamino]-5-fluoroindole-1-carbonyl]phenyl]methyl dihydrogen phosphate |
| SMILES | O=C(Nc1ccc(C2CC2)cc1)Nc1cn(C(=O)c2ccccc2COP(=O)(O)O)c2ccc(F)cc12 |
| InChI | InChI=1S/C26H23FN3O6P/c27-19-9-12-24-22(13-19)23(29-26(32)28-20-10-7-17(8-11-20)16-5-6-16)14-30(24)25(31)21-4-2-1-3-18(21)15-36-37(33,34)35/h1-4,7-14,16H,5-6,15H2,(H2,28,29,32)(H2,33,34,35) |
| InChIKey | GJYJTFOXDJSKPD-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 129.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.46 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|