C19H16FN3O3 — CID 113212468
N-(4-acetamidophenyl)-1-acetyl-5-fluoroindole-3-carboxamide (PubChem CID 113212468) has the molecular formula C19H16FN3O3 and a molecular weight of 353.35 g/mol. Its IUPAC name is N-(4-acetamidophenyl)-1-acetyl-5-fluoroindole-3-carboxamide.
| Compound Name | N-(4-acetamidophenyl)-1-acetyl-5-fluoroindole-3-carboxamide |
|---|---|
| PubChem CID | 113212468 |
| Molecular Formula | C19H16FN3O3 |
| Molecular Weight | 353.35 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | N-(4-acetamidophenyl)-1-acetyl-5-fluoroindole-3-carboxamide |
| SMILES | CC(=O)Nc1ccc(NC(=O)c2cn(C(C)=O)c3ccc(F)cc23)cc1 |
| InChI | InChI=1S/C19H16FN3O3/c1-11(24)21-14-4-6-15(7-5-14)22-19(26)17-10-23(12(2)25)18-8-3-13(20)9-16(17)18/h3-10H,1-2H3,(H,21,24)(H,22,26) |
| InChIKey | LPJPCLDYLRAUQQ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.35 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |