C22H22FN3O2 — CID 113212477
1-acetyl-5-fluoro-N-(4-piperidin-1-ylphenyl)indole-3-carboxamide (PubChem CID 113212477) has the molecular formula C22H22FN3O2 and a molecular weight of 379.44 g/mol. Its IUPAC name is 1-acetyl-5-fluoro-N-(4-piperidin-1-ylphenyl)indole-3-carboxamide.
| Compound Name | 1-acetyl-5-fluoro-N-(4-piperidin-1-ylphenyl)indole-3-carboxamide |
|---|---|
| PubChem CID | 113212477 |
| Molecular Formula | C22H22FN3O2 |
| Molecular Weight | 379.44 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | 1-acetyl-5-fluoro-N-(4-piperidin-1-ylphenyl)indole-3-carboxamide |
| SMILES | CC(=O)n1cc(C(=O)Nc2ccc(N3CCCCC3)cc2)c2cc(F)ccc21 |
| InChI | InChI=1S/C22H22FN3O2/c1-15(27)26-14-20(19-13-16(23)5-10-21(19)26)22(28)24-17-6-8-18(9-7-17)25-11-3-2-4-12-25/h5-10,13-14H,2-4,11-12H2,1H3,(H,24,28) |
| InChIKey | HHLHVRFXYYRAOO-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.44 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|