C20H20FN3O — CID 113206297
6-fluoro-N-(4-piperidin-1-ylphenyl)-1H-indole-3-carboxamide (PubChem CID 113206297) has the molecular formula C20H20FN3O and a molecular weight of 337.40 g/mol. Its IUPAC name is 6-fluoro-N-(4-piperidin-1-ylphenyl)-1H-indole-3-carboxamide.
| Compound Name | 6-fluoro-N-(4-piperidin-1-ylphenyl)-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 113206297 |
| Molecular Formula | C20H20FN3O |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | 6-fluoro-N-(4-piperidin-1-ylphenyl)-1H-indole-3-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCCCC2)cc1)c1c[nH]c2cc(F)ccc12 |
| InChI | InChI=1S/C20H20FN3O/c21-14-4-9-17-18(13-22-19(17)12-14)20(25)23-15-5-7-16(8-6-15)24-10-2-1-3-11-24/h4-9,12-13,22H,1-3,10-11H2,(H,23,25) |
| InChIKey | ZWVHNHADRGIPJP-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|