C16H10F4N2O — CID 113206284
6-fluoro-N-[4-(trifluoromethyl)phenyl]-1H-indole-3-carboxamide (PubChem CID 113206284) has the molecular formula C16H10F4N2O and a molecular weight of 322.26 g/mol. Its IUPAC name is 6-fluoro-N-[4-(trifluoromethyl)phenyl]-1H-indole-3-carboxamide.
| Compound Name | 6-fluoro-N-[4-(trifluoromethyl)phenyl]-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 113206284 |
| Molecular Formula | C16H10F4N2O |
| Molecular Weight | 322.26 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | 6-fluoro-N-[4-(trifluoromethyl)phenyl]-1H-indole-3-carboxamide |
| SMILES | O=C(Nc1ccc(C(F)(F)F)cc1)c1c[nH]c2cc(F)ccc12 |
| InChI | InChI=1S/C16H10F4N2O/c17-10-3-6-12-13(8-21-14(12)7-10)15(23)22-11-4-1-9(2-5-11)16(18,19)20/h1-8,21H,(H,22,23) |
| InChIKey | NCOAQLYXRWUAKB-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.26 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |