C17H12F4N2O — CID 113204635
5-fluoro-3-methyl-N-[4-(trifluoromethyl)phenyl]-1H-indole-2-carboxamide (PubChem CID 113204635) has the molecular formula C17H12F4N2O and a molecular weight of 336.29 g/mol. Its IUPAC name is 5-fluoro-3-methyl-N-[4-(trifluoromethyl)phenyl]-1H-indole-2-carboxamide.
| Compound Name | 5-fluoro-3-methyl-N-[4-(trifluoromethyl)phenyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 113204635 |
| Molecular Formula | C17H12F4N2O |
| Molecular Weight | 336.29 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | 5-fluoro-3-methyl-N-[4-(trifluoromethyl)phenyl]-1H-indole-2-carboxamide |
| SMILES | Cc1c(C(=O)Nc2ccc(C(F)(F)F)cc2)[nH]c2ccc(F)cc12 |
| InChI | InChI=1S/C17H12F4N2O/c1-9-13-8-11(18)4-7-14(13)23-15(9)16(24)22-12-5-2-10(3-6-12)17(19,20)21/h2-8,23H,1H3,(H,22,24) |
| InChIKey | QJFSFPMVLBHHIO-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.29 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|