C19H19FN2O4 — CID 113204658
5-fluoro-3-methyl-N-(3,4,5-trimethoxyphenyl)-1H-indole-2-carboxamide (PubChem CID 113204658) has the molecular formula C19H19FN2O4 and a molecular weight of 358.37 g/mol. Its IUPAC name is 5-fluoro-3-methyl-N-(3,4,5-trimethoxyphenyl)-1H-indole-2-carboxamide.
| Compound Name | 5-fluoro-3-methyl-N-(3,4,5-trimethoxyphenyl)-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 113204658 |
| Molecular Formula | C19H19FN2O4 |
| Molecular Weight | 358.37 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | 5-fluoro-3-methyl-N-(3,4,5-trimethoxyphenyl)-1H-indole-2-carboxamide |
| SMILES | COc1cc(NC(=O)c2[nH]c3ccc(F)cc3c2C)cc(OC)c1OC |
| InChI | InChI=1S/C19H19FN2O4/c1-10-13-7-11(20)5-6-14(13)22-17(10)19(23)21-12-8-15(24-2)18(26-4)16(9-12)25-3/h5-9,22H,1-4H3,(H,21,23) |
| InChIKey | SWGLRXMSQJYOJQ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 72.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.37 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|