C18H17FN2O4 — CID 113205749
5-fluoro-N-(3,4,5-trimethoxyphenyl)-1H-indole-3-carboxamide (PubChem CID 113205749) has the molecular formula C18H17FN2O4 and a molecular weight of 344.34 g/mol. Its IUPAC name is 5-fluoro-N-(3,4,5-trimethoxyphenyl)-1H-indole-3-carboxamide.
| Compound Name | 5-fluoro-N-(3,4,5-trimethoxyphenyl)-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 113205749 |
| Molecular Formula | C18H17FN2O4 |
| Molecular Weight | 344.34 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | 5-fluoro-N-(3,4,5-trimethoxyphenyl)-1H-indole-3-carboxamide |
| SMILES | COc1cc(NC(=O)c2c[nH]c3ccc(F)cc23)cc(OC)c1OC |
| InChI | InChI=1S/C18H17FN2O4/c1-23-15-7-11(8-16(24-2)17(15)25-3)21-18(22)13-9-20-14-5-4-10(19)6-12(13)14/h4-9,20H,1-3H3,(H,21,22) |
| InChIKey | JNGQCPOYEDAANE-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 72.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.34 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |