C18H17ClN2O4 — CID 113205929
5-chloro-N-(3,4,5-trimethoxyphenyl)-1H-indole-3-carboxamide (PubChem CID 113205929) has the molecular formula C18H17ClN2O4 and a molecular weight of 360.80 g/mol. Its IUPAC name is 5-chloro-N-(3,4,5-trimethoxyphenyl)-1H-indole-3-carboxamide.
| Compound Name | 5-chloro-N-(3,4,5-trimethoxyphenyl)-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 113205929 |
| Molecular Formula | C18H17ClN2O4 |
| Molecular Weight | 360.80 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | 5-chloro-N-(3,4,5-trimethoxyphenyl)-1H-indole-3-carboxamide |
| SMILES | COc1cc(NC(=O)c2c[nH]c3ccc(Cl)cc23)cc(OC)c1OC |
| InChI | InChI=1S/C18H17ClN2O4/c1-23-15-7-11(8-16(24-2)17(15)25-3)21-18(22)13-9-20-14-5-4-10(19)6-12(13)14/h4-9,20H,1-3H3,(H,21,22) |
| InChIKey | KZQCFYRDRAODDQ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 72.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.80 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |