C16H12Cl2N2O2 — CID 113206123
N-(3,4-dichlorophenyl)-5-methoxy-1H-indole-3-carboxamide (PubChem CID 113206123) has the molecular formula C16H12Cl2N2O2 and a molecular weight of 335.19 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-5-methoxy-1H-indole-3-carboxamide.
| Compound Name | N-(3,4-dichlorophenyl)-5-methoxy-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 113206123 |
| Molecular Formula | C16H12Cl2N2O2 |
| Molecular Weight | 335.19 g/mol |
| Exact Mass | 334.03 |
| IUPAC Name | N-(3,4-dichlorophenyl)-5-methoxy-1H-indole-3-carboxamide |
| SMILES | COc1ccc2[nH]cc(C(=O)Nc3ccc(Cl)c(Cl)c3)c2c1 |
| InChI | InChI=1S/C16H12Cl2N2O2/c1-22-10-3-5-15-11(7-10)12(8-19-15)16(21)20-9-2-4-13(17)14(18)6-9/h2-8,19H,1H3,(H,20,21) |
| InChIKey | YCKJJDNAFIIMMY-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.19 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |