C17H15ClN2O3 — CID 113206630
N-(3-chloro-4-methoxyphenyl)-6-methoxy-1H-indole-3-carboxamide (PubChem CID 113206630) has the molecular formula C17H15ClN2O3 and a molecular weight of 330.77 g/mol. Its IUPAC name is N-(3-chloro-4-methoxyphenyl)-6-methoxy-1H-indole-3-carboxamide.
| Compound Name | N-(3-chloro-4-methoxyphenyl)-6-methoxy-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 113206630 |
| Molecular Formula | C17H15ClN2O3 |
| Molecular Weight | 330.77 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | N-(3-chloro-4-methoxyphenyl)-6-methoxy-1H-indole-3-carboxamide |
| SMILES | COc1ccc2c(C(=O)Nc3ccc(OC)c(Cl)c3)c[nH]c2c1 |
| InChI | InChI=1S/C17H15ClN2O3/c1-22-11-4-5-12-13(9-19-15(12)8-11)17(21)20-10-3-6-16(23-2)14(18)7-10/h3-9,19H,1-2H3,(H,20,21) |
| InChIKey | TWWQMLTWDJYZDY-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 63.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.77 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |