C19H20N2O5 — CID 113206118
5-methoxy-N-(3,4,5-trimethoxyphenyl)-1H-indole-3-carboxamide (PubChem CID 113206118) has the molecular formula C19H20N2O5 and a molecular weight of 356.38 g/mol. Its IUPAC name is 5-methoxy-N-(3,4,5-trimethoxyphenyl)-1H-indole-3-carboxamide.
| Compound Name | 5-methoxy-N-(3,4,5-trimethoxyphenyl)-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 113206118 |
| Molecular Formula | C19H20N2O5 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | 5-methoxy-N-(3,4,5-trimethoxyphenyl)-1H-indole-3-carboxamide |
| SMILES | COc1ccc2[nH]cc(C(=O)Nc3cc(OC)c(OC)c(OC)c3)c2c1 |
| InChI | InChI=1S/C19H20N2O5/c1-23-12-5-6-15-13(9-12)14(10-20-15)19(22)21-11-7-16(24-2)18(26-4)17(8-11)25-3/h5-10,20H,1-4H3,(H,21,22) |
| InChIKey | NWYSSTPTYXWBHF-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 81.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |