C18H14ClFN2O4 — CID 113208188
N-(4-chloro-2,5-dimethoxyphenyl)-2-(5-fluoro-1H-indol-3-yl)-2-oxoacetamide (PubChem CID 113208188) has the molecular formula C18H14ClFN2O4 and a molecular weight of 376.77 g/mol. Its IUPAC name is N-(4-chloro-2,5-dimethoxyphenyl)-2-(5-fluoro-1H-indol-3-yl)-2-oxoacetamide.
| Compound Name | N-(4-chloro-2,5-dimethoxyphenyl)-2-(5-fluoro-1H-indol-3-yl)-2-oxoacetamide |
|---|---|
| PubChem CID | 113208188 |
| Molecular Formula | C18H14ClFN2O4 |
| Molecular Weight | 376.77 g/mol |
| Exact Mass | 376.06 |
| IUPAC Name | N-(4-chloro-2,5-dimethoxyphenyl)-2-(5-fluoro-1H-indol-3-yl)-2-oxoacetamide |
| SMILES | COc1cc(NC(=O)C(=O)c2c[nH]c3ccc(F)cc23)c(OC)cc1Cl |
| InChI | InChI=1S/C18H14ClFN2O4/c1-25-15-7-14(16(26-2)6-12(15)19)22-18(24)17(23)11-8-21-13-4-3-9(20)5-10(11)13/h3-8,21H,1-2H3,(H,22,24) |
| InChIKey | BJPSZRYIBPYSDW-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 80.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.77 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|