C16H15ClFNO4 — CID 8501524
N-(4-chloro-2,5-dimethoxyphenyl)-2-(4-fluorophenoxy)acetamide (PubChem CID 8501524) has the molecular formula C16H15ClFNO4 and a molecular weight of 339.75 g/mol. Its IUPAC name is N-(4-chloro-2,5-dimethoxyphenyl)-2-(4-fluorophenoxy)acetamide.
| Compound Name | N-(4-chloro-2,5-dimethoxyphenyl)-2-(4-fluorophenoxy)acetamide |
|---|---|
| PubChem CID | 8501524 |
| Molecular Formula | C16H15ClFNO4 |
| Molecular Weight | 339.75 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | N-(4-chloro-2,5-dimethoxyphenyl)-2-(4-fluorophenoxy)acetamide |
| SMILES | COc1cc(NC(=O)COc2ccc(F)cc2)c(OC)cc1Cl |
| InChI | InChI=1S/C16H15ClFNO4/c1-21-14-8-13(15(22-2)7-12(14)17)19-16(20)9-23-11-5-3-10(18)4-6-11/h3-8H,9H2,1-2H3,(H,19,20) |
| InChIKey | WRSWGXVQNVRMQD-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.75 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |