C18H19ClFNO4 — CID 86919968
N-(4-chloro-2,5-dimethoxyphenyl)-4-(4-fluorophenoxy)butanamide (PubChem CID 86919968) has the molecular formula C18H19ClFNO4 and a molecular weight of 367.80 g/mol. Its IUPAC name is N-(4-chloro-2,5-dimethoxyphenyl)-4-(4-fluorophenoxy)butanamide.
| Compound Name | N-(4-chloro-2,5-dimethoxyphenyl)-4-(4-fluorophenoxy)butanamide |
|---|---|
| PubChem CID | 86919968 |
| Molecular Formula | C18H19ClFNO4 |
| Molecular Weight | 367.80 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | N-(4-chloro-2,5-dimethoxyphenyl)-4-(4-fluorophenoxy)butanamide |
| SMILES | COc1cc(NC(=O)CCCOc2ccc(F)cc2)c(OC)cc1Cl |
| InChI | InChI=1S/C18H19ClFNO4/c1-23-16-11-15(17(24-2)10-14(16)19)21-18(22)4-3-9-25-13-7-5-12(20)6-8-13/h5-8,10-11H,3-4,9H2,1-2H3,(H,21,22) |
| InChIKey | RKLWGZCSXJANHM-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.80 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|