C16H14Cl2FNO2 — CID 46534875
N-(2,3-dichlorophenyl)-4-(4-fluorophenoxy)butanamide (PubChem CID 46534875) has the molecular formula C16H14Cl2FNO2 and a molecular weight of 342.20 g/mol. Its IUPAC name is N-(2,3-dichlorophenyl)-4-(4-fluorophenoxy)butanamide.
| Compound Name | N-(2,3-dichlorophenyl)-4-(4-fluorophenoxy)butanamide |
|---|---|
| PubChem CID | 46534875 |
| Molecular Formula | C16H14Cl2FNO2 |
| Molecular Weight | 342.20 g/mol |
| Exact Mass | 341.04 |
| IUPAC Name | N-(2,3-dichlorophenyl)-4-(4-fluorophenoxy)butanamide |
| SMILES | O=C(CCCOc1ccc(F)cc1)Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C16H14Cl2FNO2/c17-13-3-1-4-14(16(13)18)20-15(21)5-2-10-22-12-8-6-11(19)7-9-12/h1,3-4,6-9H,2,5,10H2,(H,20,21) |
| InChIKey | FNYQXZMBYKMGSR-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.20 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|