C17H17BrClNO2 — CID 18292221
4-(4-bromophenoxy)-N-(3-chloro-2-methylphenyl)butanamide (PubChem CID 18292221) has the molecular formula C17H17BrClNO2 and a molecular weight of 382.69 g/mol. Its IUPAC name is 4-(4-bromophenoxy)-N-(3-chloro-2-methylphenyl)butanamide.
| Compound Name | 4-(4-bromophenoxy)-N-(3-chloro-2-methylphenyl)butanamide |
|---|---|
| PubChem CID | 18292221 |
| Molecular Formula | C17H17BrClNO2 |
| Molecular Weight | 382.69 g/mol |
| Exact Mass | 381.01 |
| IUPAC Name | 4-(4-bromophenoxy)-N-(3-chloro-2-methylphenyl)butanamide |
| SMILES | Cc1c(Cl)cccc1NC(=O)CCCOc1ccc(Br)cc1 |
| InChI | InChI=1S/C17H17BrClNO2/c1-12-15(19)4-2-5-16(12)20-17(21)6-3-11-22-14-9-7-13(18)8-10-14/h2,4-5,7-10H,3,6,11H2,1H3,(H,20,21) |
| InChIKey | GNPVCCOPUSKNSU-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.69 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|