C20H22Cl2N2O2 — CID 4050802
N,N'-bis(3-chloro-2-methylphenyl)hexanediamide (PubChem CID 4050802) has the molecular formula C20H22Cl2N2O2 and a molecular weight of 393.31 g/mol. Its IUPAC name is N,N'-bis(3-chloro-2-methylphenyl)hexanediamide.
| Compound Name | N,N'-bis(3-chloro-2-methylphenyl)hexanediamide |
|---|---|
| PubChem CID | 4050802 |
| Molecular Formula | C20H22Cl2N2O2 |
| Molecular Weight | 393.31 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | N,N'-bis(3-chloro-2-methylphenyl)hexanediamide |
| SMILES | Cc1c(Cl)cccc1NC(=O)CCCCC(=O)Nc1cccc(Cl)c1C |
| InChI | InChI=1S/C20H22Cl2N2O2/c1-13-15(21)7-5-9-17(13)23-19(25)11-3-4-12-20(26)24-18-10-6-8-16(22)14(18)2/h5-10H,3-4,11-12H2,1-2H3,(H,23,25)(H,24,26) |
| InChIKey | GROAXFNJDXAKDX-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.31 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|