C20H22Cl2N2O2S — CID 2168392
3-[3-(3-chloro-2-methylanilino)-3-oxopropyl]sulfanyl-N-(3-chloro-2-methylphenyl)propanamide (PubChem CID 2168392) has the molecular formula C20H22Cl2N2O2S and a molecular weight of 425.38 g/mol. Its IUPAC name is 3-[3-(3-chloro-2-methylanilino)-3-oxopropyl]sulfanyl-N-(3-chloro-2-methylphenyl)propanamide.
| Compound Name | 3-[3-(3-chloro-2-methylanilino)-3-oxopropyl]sulfanyl-N-(3-chloro-2-methylphenyl)propanamide |
|---|---|
| PubChem CID | 2168392 |
| Molecular Formula | C20H22Cl2N2O2S |
| Molecular Weight | 425.38 g/mol |
| Exact Mass | 424.08 |
| IUPAC Name | 3-[3-(3-chloro-2-methylanilino)-3-oxopropyl]sulfanyl-N-(3-chloro-2-methylphenyl)propanamide |
| SMILES | Cc1c(Cl)cccc1NC(=O)CCSCCC(=O)Nc1cccc(Cl)c1C |
| InChI | InChI=1S/C20H22Cl2N2O2S/c1-13-15(21)5-3-7-17(13)23-19(25)9-11-27-12-10-20(26)24-18-8-4-6-16(22)14(18)2/h3-8H,9-12H2,1-2H3,(H,23,25)(H,24,26) |
| InChIKey | AWFOZWHBNGXBNN-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.38 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|