C15H14Cl2N2O — CID 588174
1,3-bis(3-chloro-2-methylphenyl)urea (PubChem CID 588174) has the molecular formula C15H14Cl2N2O and a molecular weight of 309.20 g/mol. Its IUPAC name is 1,3-bis(3-chloro-2-methylphenyl)urea.
| Compound Name | 1,3-bis(3-chloro-2-methylphenyl)urea |
|---|---|
| PubChem CID | 588174 |
| Molecular Formula | C15H14Cl2N2O |
| Molecular Weight | 309.20 g/mol |
| Exact Mass | 308.05 |
| IUPAC Name | 1,3-bis(3-chloro-2-methylphenyl)urea |
| SMILES | Cc1c(Cl)cccc1NC(=O)Nc1cccc(Cl)c1C |
| InChI | InChI=1S/C15H14Cl2N2O/c1-9-11(16)5-3-7-13(9)18-15(20)19-14-8-4-6-12(17)10(14)2/h3-8H,1-2H3,(H2,18,19,20) |
| InChIKey | LBQBQPFLWWVOMO-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.20 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |