C10H12ClNOS — CID 83768417
N-(3-chloro-2-methylphenyl)-2-sulfanylpropanamide (PubChem CID 83768417) has the molecular formula C10H12ClNOS and a molecular weight of 229.73 g/mol. Its IUPAC name is N-(3-chloro-2-methylphenyl)-2-sulfanylpropanamide.
| Compound Name | N-(3-chloro-2-methylphenyl)-2-sulfanylpropanamide |
|---|---|
| PubChem CID | 83768417 |
| Molecular Formula | C10H12ClNOS |
| Molecular Weight | 229.73 g/mol |
| Exact Mass | 229.03 |
| IUPAC Name | N-(3-chloro-2-methylphenyl)-2-sulfanylpropanamide |
| SMILES | Cc1c(Cl)cccc1NC(=O)C(C)S |
| InChI | InChI=1S/C10H12ClNOS/c1-6-8(11)4-3-5-9(6)12-10(13)7(2)14/h3-5,7,14H,1-2H3,(H,12,13) |
| InChIKey | SJSWOOYJHWDLJN-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.73 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|