C19H22ClNO4 — CID 55572968
N-(4-chloro-2,5-dimethoxyphenyl)-3-(3,4-dimethylphenoxy)propanamide (PubChem CID 55572968) has the molecular formula C19H22ClNO4 and a molecular weight of 363.84 g/mol. Its IUPAC name is N-(4-chloro-2,5-dimethoxyphenyl)-3-(3,4-dimethylphenoxy)propanamide.
| Compound Name | N-(4-chloro-2,5-dimethoxyphenyl)-3-(3,4-dimethylphenoxy)propanamide |
|---|---|
| PubChem CID | 55572968 |
| Molecular Formula | C19H22ClNO4 |
| Molecular Weight | 363.84 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | N-(4-chloro-2,5-dimethoxyphenyl)-3-(3,4-dimethylphenoxy)propanamide |
| SMILES | COc1cc(NC(=O)CCOc2ccc(C)c(C)c2)c(OC)cc1Cl |
| InChI | InChI=1S/C19H22ClNO4/c1-12-5-6-14(9-13(12)2)25-8-7-19(22)21-16-11-17(23-3)15(20)10-18(16)24-4/h5-6,9-11H,7-8H2,1-4H3,(H,21,22) |
| InChIKey | ISXYOBRXXXSINL-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.84 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |