C19H23NO2 — CID 39992819
3-(3,4-dimethylphenoxy)-N-(2-ethylphenyl)propanamide (PubChem CID 39992819) has the molecular formula C19H23NO2 and a molecular weight of 297.40 g/mol. Its IUPAC name is 3-(3,4-dimethylphenoxy)-N-(2-ethylphenyl)propanamide.
| Compound Name | 3-(3,4-dimethylphenoxy)-N-(2-ethylphenyl)propanamide |
|---|---|
| PubChem CID | 39992819 |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | 3-(3,4-dimethylphenoxy)-N-(2-ethylphenyl)propanamide |
| SMILES | CCc1ccccc1NC(=O)CCOc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C19H23NO2/c1-4-16-7-5-6-8-18(16)20-19(21)11-12-22-17-10-9-14(2)15(3)13-17/h5-10,13H,4,11-12H2,1-3H3,(H,20,21) |
| InChIKey | XHNSEFYPMDPUQI-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |